| Name | L-serine benzyl ester hydrochloride |
| Synonyms | H-Ser-OBzl·HCl H-SER-OBZL HCL H-Ser-Obzl Hcl H-SER-OBZL·HCL SERINE-OBZL HCL H-Ser-OBzl . HCl L-SerinebenzylesterHCl L-serine benzyl ester hcl benzyl serinate hydrochloride L-serine benzyl ester hydrochloride L-SERINE BENZYL ESTER HYDROCHLORIDE L-β-Hydroxyalanine benzyl ester hydrochloride benzyl 2-aMino-3-hydroxypropanoate hydrochloride (2S)-1-(benzyloxy)-3-hydroxy-1-oxopropan-2-aminium chloride |
| CAS | 60022-62-0 1738-72-3 |
| InChI | InChI=1/C10H13NO3.ClH/c11-9(6-12)10(13)14-7-8-4-2-1-3-5-8;/h1-5,9,12H,6-7,11H2;1H/t9-;/m0./s1 |
| InChIKey | MGZWCDQAKCHOBX-FVGYRXGTSA-N |
| Molecular Formula | C10H14ClNO3 |
| Molar Mass | 231.68 |
| Melting Point | 175°C |
| Boling Point | 360.4°C at 760 mmHg |
| Flash Point | 171.8°C |
| Water Solubility | Soluble in water. |
| Vapor Presure | 8E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | -12 ° (C=1, H2O) |
| MDL | MFCD00038955 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29225090 |